C12H17N3O2 — CID 126732379
2-methyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide (PubChem CID 126732379) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-methyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide.
| Compound Name | 2-methyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide |
|---|---|
| PubChem CID | 126732379 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-methyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide |
| SMILES | CC(C)C(=O)N[C@@H](C)C(=O)/C=C/c1ccn[nH]1 |
| InChI | InChI=1S/C12H17N3O2/c1-8(2)12(17)14-9(3)11(16)5-4-10-6-7-13-15-10/h4-9H,1-3H3,(H,13,15)(H,14,17)/b5-4+/t9-/m0/s1 |
| InChIKey | FXSNVIQIDIFHSH-MOVJSRMASA-N |
| XLogP | 1.15 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|