C12H13N3O2 — CID 138634729
1-[(E)-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 138634729) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-[(E)-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(E)-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 138634729 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-[(E)-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | Cc1[nH]ncc1/C=C/C(=O)N1CCC=CC1=O |
| InChI | InChI=1S/C12H13N3O2/c1-9-10(8-13-14-9)5-6-12(17)15-7-3-2-4-11(15)16/h2,4-6,8H,3,7H2,1H3,(H,13,14)/b6-5+ |
| InChIKey | UJCBPWDZWREOIK-AATRIKPKSA-N |
| XLogP | 1.05 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|