About 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide
2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide (PubChem CID 126731813) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide.
Molecular Properties
| Compound Name | 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide |
| PubChem CID | 126731813 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide |
| SMILES | C[C@H](NC(=O)C(C)(C)C)C(=O)/C=C/c1ccn[nH]1 |
| InChI | InChI=1S/C13H19N3O2/c1-9(15-12(18)13(2,3)4)11(17)6-5-10-7-8-14-16-10/h5-9H,1-4H3,(H,14,16)(H,15,18)/b6-5+/t9-/m0/s1 |
| InChIKey | BYJRIEXOYICOIZ-CYNONHLPSA-N |
| XLogP | 1.54 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide?
The IUPAC name of 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide (CID 126731813) is 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide.
What is the SMILES notation for 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide?
The canonical SMILES for 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide is C[C@H](NC(=O)C(C)(C)C)C(=O)/C=C/c1ccn[nH]1.
What is the InChIKey of 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide?
The InChIKey is BYJRIEXOYICOIZ-CYNONHLPSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-9(15-12(18)13(2,3)4)11(17)6-5-10-7-8-14-16-10/h5-9H,1-4H3,(H,14,16)(H,15,18)/b6-5+/t9-/m0/s1.
What are the key properties of 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide?
2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide has a molecular weight of 249.31 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]propanamide is sourced from PubChem (CID 126731813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).