C10H13N3O2 — CID 118532000
N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]acetamide (PubChem CID 118532000) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]acetamide.
| Compound Name | N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 118532000 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-[(E,2S)-3-oxo-5-(1H-pyrazol-5-yl)pent-4-en-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C)C(=O)/C=C/c1ccn[nH]1 |
| InChI | InChI=1S/C10H13N3O2/c1-7(12-8(2)14)10(15)4-3-9-5-6-11-13-9/h3-7H,1-2H3,(H,11,13)(H,12,14)/b4-3+/t7-/m0/s1 |
| InChIKey | FZPIGLREURXNHJ-SDLBARTOSA-N |
| XLogP | 0.52 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|