C13H15N3O2 — CID 138634770
1-[(E)-2-methyl-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 138634770) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-[(E)-2-methyl-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(E)-2-methyl-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 138634770 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-[(E)-2-methyl-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | C/C(=C\c1cn[nH]c1C)C(=O)N1CCC=CC1=O |
| InChI | InChI=1S/C13H15N3O2/c1-9(7-11-8-14-15-10(11)2)13(18)16-6-4-3-5-12(16)17/h3,5,7-8H,4,6H2,1-2H3,(H,14,15)/b9-7+ |
| InChIKey | GBWIIWGKOYUOLR-VQHVLOKHSA-N |
| XLogP | 1.44 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|