C18H27N — CID 138637485
(3Z,5E,8Z)-9-(cyclopropylmethyl)-N,3,8-trimethylundeca-1,3,5,8,10-pentaen-6-amine (PubChem CID 138637485) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is (3Z,5E,8Z)-9-(cyclopropylmethyl)-N,3,8-trimethylundeca-1,3,5,8,10-pentaen-6-amine.
| Compound Name | (3Z,5E,8Z)-9-(cyclopropylmethyl)-N,3,8-trimethylundeca-1,3,5,8,10-pentaen-6-amine |
|---|---|
| PubChem CID | 138637485 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | (3Z,5E,8Z)-9-(cyclopropylmethyl)-N,3,8-trimethylundeca-1,3,5,8,10-pentaen-6-amine |
| SMILES | C=C/C(C)=C\C=C(/C/C(C)=C(\C=C)CC1CC1)NC |
| InChI | InChI=1S/C18H27N/c1-6-14(3)8-11-18(19-5)12-15(4)17(7-2)13-16-9-10-16/h6-8,11,16,19H,1-2,9-10,12-13H2,3-5H3/b14-8-,17-15+,18-11+ |
| InChIKey | NAEOFUDEZLOIBV-RNMRVBDVSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|