C21H28N4O2 — CID 138642430
(2Z,4E)-4-[5-(aminomethyl)-1-[[(2S)-oxolan-2-yl]methyl]benzimidazol-2-yl]-5-(dimethylamino)-2-methylpenta-2,4-dienal (PubChem CID 138642430) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is (2Z,4E)-4-[5-(aminomethyl)-1-[[(2S)-oxolan-2-yl]methyl]benzimidazol-2-yl]-5-(dimethylamino)-2-methylpenta-2,4-dienal.
| Compound Name | (2Z,4E)-4-[5-(aminomethyl)-1-[[(2S)-oxolan-2-yl]methyl]benzimidazol-2-yl]-5-(dimethylamino)-2-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 138642430 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (2Z,4E)-4-[5-(aminomethyl)-1-[[(2S)-oxolan-2-yl]methyl]benzimidazol-2-yl]-5-(dimethylamino)-2-methylpenta-2,4-dienal |
| SMILES | C/C(C=O)=C/C(=C\N(C)C)c1nc2cc(CN)ccc2n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H28N4O2/c1-15(14-26)9-17(12-24(2)3)21-23-19-10-16(11-22)6-7-20(19)25(21)13-18-5-4-8-27-18/h6-7,9-10,12,14,18H,4-5,8,11,13,22H2,1-3H3/b15-9-,17-12+/t18-/m0/s1 |
| InChIKey | QEDNGNUBRWZCGN-TXICWWNZSA-N |
| XLogP | 2.72 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|