C31H43N3O5 — CID 139566771
(4S)-3-[[2-[(2E,4Z)-5,7-dimethyl-6-oxonona-2,4-dien-3-yl]-1-[[(2S)-oxolan-2-yl]methyl]benzimidazol-5-yl]methyl]-4-[(1R)-1-hydroxyethyl]-2,2-dimethyl-1,3-oxazolidin-5-one (PubChem CID 139566771) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is (4S)-3-[[2-[(2E,4Z)-5,7-dimethyl-6-oxonona-2,4-dien-3-yl]-1-[[(2S)-oxolan-2-yl]methyl]benzimidazol-5-yl]methyl]-4-[(1R)-1-hydroxyethyl]-2,2-dimethyl-1,3-oxazolidin-5-one.
| Compound Name | (4S)-3-[[2-[(2E,4Z)-5,7-dimethyl-6-oxonona-2,4-dien-3-yl]-1-[[(2S)-oxolan-2-yl]methyl]benzimidazol-5-yl]methyl]-4-[(1R)-1-hydroxyethyl]-2,2-dimethyl-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 139566771 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | (4S)-3-[[2-[(2E,4Z)-5,7-dimethyl-6-oxonona-2,4-dien-3-yl]-1-[[(2S)-oxolan-2-yl]methyl]benzimidazol-5-yl]methyl]-4-[(1R)-1-hydroxyethyl]-2,2-dimethyl-1,3-oxazolidin-5-one |
| SMILES | C/C=C(\C=C(\C)C(=O)C(C)CC)c1nc2cc(CN3[C@@H]([C@@H](C)O)C(=O)OC3(C)C)ccc2n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C31H43N3O5/c1-8-19(3)28(36)20(4)15-23(9-2)29-32-25-16-22(12-13-26(25)33(29)18-24-11-10-14-38-24)17-34-27(21(5)35)30(37)39-31(34,6)7/h9,12-13,15-16,19,21,24,27,35H,8,10-11,14,17-18H2,1-7H3/b20-15-,23-9+/t19?,21-,24+,27+/m1/s1 |
| InChIKey | VDNTUOWEGXLHRV-ZSGFTPNGSA-N |
| XLogP | 5.02 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|