C33H51N3O5 — CID 145155171
ethane;2-methoxyethyl 3-methyl-2-[[2-[(2E,4Z)-5-methyl-6-oxoocta-2,4-dien-3-yl]-1-(oxan-4-ylmethyl)benzimidazol-5-yl]methylamino]butanoate (PubChem CID 145155171) has the molecular formula C33H51N3O5 and a molecular weight of 569.79 g/mol. Its IUPAC name is ethane;2-methoxyethyl 3-methyl-2-[[2-[(2E,4Z)-5-methyl-6-oxoocta-2,4-dien-3-yl]-1-(oxan-4-ylmethyl)benzimidazol-5-yl]methylamino]butanoate.
| Compound Name | ethane;2-methoxyethyl 3-methyl-2-[[2-[(2E,4Z)-5-methyl-6-oxoocta-2,4-dien-3-yl]-1-(oxan-4-ylmethyl)benzimidazol-5-yl]methylamino]butanoate |
|---|---|
| PubChem CID | 145155171 |
| Molecular Formula | C33H51N3O5 |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.38 |
| IUPAC Name | ethane;2-methoxyethyl 3-methyl-2-[[2-[(2E,4Z)-5-methyl-6-oxoocta-2,4-dien-3-yl]-1-(oxan-4-ylmethyl)benzimidazol-5-yl]methylamino]butanoate |
| SMILES | C/C=C(\C=C(\C)C(=O)CC)c1nc2cc(CNC(C(=O)OCCOC)C(C)C)ccc2n1CC1CCOCC1.CC |
| InChI | InChI=1S/C31H45N3O5.C2H6/c1-7-25(17-22(5)28(35)8-2)30-33-26-18-24(19-32-29(21(3)4)31(36)39-16-15-37-6)9-10-27(26)34(30)20-23-11-13-38-14-12-23;1-2/h7,9-10,17-18,21,23,29,32H,8,11-16,19-20H2,1-6H3;1-2H3/b22-17-,25-7+; |
| InChIKey | CKZBBTCHOZEKLJ-FNZJUPBPSA-N |
| XLogP | 6.12 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|