C32H53N3O5 — CID 145155220
(5Z,7E)-7-[5-(aminomethyl)-1-(2-methoxyethyl)benzimidazol-2-yl]-3,5-dimethylnona-5,7-dien-4-one;ethane;2-methylpropyl (3R)-3-hydroxybutanoate (PubChem CID 145155220) has the molecular formula C32H53N3O5 and a molecular weight of 559.79 g/mol. Its IUPAC name is (5Z,7E)-7-[5-(aminomethyl)-1-(2-methoxyethyl)benzimidazol-2-yl]-3,5-dimethylnona-5,7-dien-4-one;ethane;2-methylpropyl (3R)-3-hydroxybutanoate.
| Compound Name | (5Z,7E)-7-[5-(aminomethyl)-1-(2-methoxyethyl)benzimidazol-2-yl]-3,5-dimethylnona-5,7-dien-4-one;ethane;2-methylpropyl (3R)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 145155220 |
| Molecular Formula | C32H53N3O5 |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.40 |
| IUPAC Name | (5Z,7E)-7-[5-(aminomethyl)-1-(2-methoxyethyl)benzimidazol-2-yl]-3,5-dimethylnona-5,7-dien-4-one;ethane;2-methylpropyl (3R)-3-hydroxybutanoate |
| SMILES | C/C=C(\C=C(\C)C(=O)C(C)CC)c1nc2cc(CN)ccc2n1CCOC.CC.CC(C)COC(=O)C[C@@H](C)O |
| InChI | InChI=1S/C22H31N3O2.C8H16O3.C2H6/c1-6-15(3)21(26)16(4)12-18(7-2)22-24-19-13-17(14-23)8-9-20(19)25(22)10-11-27-5;1-6(2)5-11-8(10)4-7(3)9;1-2/h7-9,12-13,15H,6,10-11,14,23H2,1-5H3;6-7,9H,4-5H2,1-3H3;1-2H3/b16-12-,18-7+;;/t;7-;/m.1./s1 |
| InChIKey | GROYDNXDYMBGOP-CCVSVIGDSA-N |
| XLogP | 6.09 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|