C23H27N5O2S — CID 138647119
N-(4-methoxyphenyl)-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methylpyrimidin-4-amine (PubChem CID 138647119) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methylpyrimidin-4-amine.
| Compound Name | N-(4-methoxyphenyl)-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 138647119 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methylpyrimidin-4-amine |
| SMILES | COc1ccc(Nc2cc(C)nc(N3CCN(Sc4cccc(OC)c4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H27N5O2S/c1-17-15-22(25-18-7-9-19(29-2)10-8-18)26-23(24-17)27-11-13-28(14-12-27)31-21-6-4-5-20(16-21)30-3/h4-10,15-16H,11-14H2,1-3H3,(H,24,25,26) |
| InChIKey | CYVVDUUUIBJPNR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|