C16H19ClN4OS — CID 138647349
4-chloro-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methylpyrimidine (PubChem CID 138647349) has the molecular formula C16H19ClN4OS and a molecular weight of 350.88 g/mol. Its IUPAC name is 4-chloro-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methylpyrimidine.
| Compound Name | 4-chloro-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methylpyrimidine |
|---|---|
| PubChem CID | 138647349 |
| Molecular Formula | C16H19ClN4OS |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4-chloro-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methylpyrimidine |
| SMILES | COc1cccc(SN2CCN(c3nc(C)cc(Cl)n3)CC2)c1 |
| InChI | InChI=1S/C16H19ClN4OS/c1-12-10-15(17)19-16(18-12)20-6-8-21(9-7-20)23-14-5-3-4-13(11-14)22-2/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | ADOVNSBFWCEACQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|