C21H24N6OS — CID 145171477
2-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methyl-N-pyridin-3-ylpyrimidin-4-amine (PubChem CID 145171477) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methyl-N-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | 2-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methyl-N-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 145171477 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)sulfanylpiperazin-1-yl]-6-methyl-N-pyridin-3-ylpyrimidin-4-amine |
| SMILES | COc1ccc(SN2CCN(c3nc(C)cc(Nc4cccnc4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H24N6OS/c1-16-14-20(24-17-4-3-9-22-15-17)25-21(23-16)26-10-12-27(13-11-26)29-19-7-5-18(28-2)6-8-19/h3-9,14-15H,10-13H2,1-2H3,(H,23,24,25) |
| InChIKey | HVZBXOAJHDDQTQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|