C24H28FN5OS — CID 145171389
N-(4-fluorophenyl)-2-[4-(4-methoxyphenyl)sulfanyl-3,3-dimethylpiperazin-1-yl]-6-methylpyrimidin-4-amine (PubChem CID 145171389) has the molecular formula C24H28FN5OS and a molecular weight of 453.59 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-(4-methoxyphenyl)sulfanyl-3,3-dimethylpiperazin-1-yl]-6-methylpyrimidin-4-amine.
| Compound Name | N-(4-fluorophenyl)-2-[4-(4-methoxyphenyl)sulfanyl-3,3-dimethylpiperazin-1-yl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 145171389 |
| Molecular Formula | C24H28FN5OS |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-(4-methoxyphenyl)sulfanyl-3,3-dimethylpiperazin-1-yl]-6-methylpyrimidin-4-amine |
| SMILES | COc1ccc(SN2CCN(c3nc(C)cc(Nc4ccc(F)cc4)n3)CC2(C)C)cc1 |
| InChI | InChI=1S/C24H28FN5OS/c1-17-15-22(27-19-7-5-18(25)6-8-19)28-23(26-17)29-13-14-30(24(2,3)16-29)32-21-11-9-20(31-4)10-12-21/h5-12,15H,13-14,16H2,1-4H3,(H,26,27,28) |
| InChIKey | WLZQCONPYZDTNY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|