C13H30N2O — CID 138647319
2,3-diamino-4,5,6,7-tetramethylnonan-5-ol (PubChem CID 138647319) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is 2,3-diamino-4,5,6,7-tetramethylnonan-5-ol.
| Compound Name | 2,3-diamino-4,5,6,7-tetramethylnonan-5-ol |
|---|---|
| PubChem CID | 138647319 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 2,3-diamino-4,5,6,7-tetramethylnonan-5-ol |
| SMILES | CCC(C)C(C)C(C)(O)C(C)C(N)C(C)N |
| InChI | InChI=1S/C13H30N2O/c1-7-8(2)9(3)13(6,16)10(4)12(15)11(5)14/h8-12,16H,7,14-15H2,1-6H3 |
| InChIKey | DWGDLYZWCHVPFF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |