C24H24N10 — CID 138649265
2-[2-[4-[6-(diaminomethylideneamino)-1-methylbenzimidazol-2-yl]phenyl]-3-methylbenzimidazol-5-yl]guanidine (PubChem CID 138649265) has the molecular formula C24H24N10 and a molecular weight of 452.53 g/mol. Its IUPAC name is 2-[2-[4-[6-(diaminomethylideneamino)-1-methylbenzimidazol-2-yl]phenyl]-3-methylbenzimidazol-5-yl]guanidine.
| Compound Name | 2-[2-[4-[6-(diaminomethylideneamino)-1-methylbenzimidazol-2-yl]phenyl]-3-methylbenzimidazol-5-yl]guanidine |
|---|---|
| PubChem CID | 138649265 |
| Molecular Formula | C24H24N10 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-[2-[4-[6-(diaminomethylideneamino)-1-methylbenzimidazol-2-yl]phenyl]-3-methylbenzimidazol-5-yl]guanidine |
| SMILES | Cn1c(-c2ccc(-c3nc4ccc(N=C(N)N)cc4n3C)cc2)nc2ccc(N=C(N)N)cc21 |
| InChI | InChI=1S/C24H24N10/c1-33-19-11-15(29-23(25)26)7-9-17(19)31-21(33)13-3-5-14(6-4-13)22-32-18-10-8-16(30-24(27)28)12-20(18)34(22)2/h3-12H,1-2H3,(H4,25,26,29)(H4,27,28,30) |
| InChIKey | KMWWPJNMWFGLID-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 164.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|