C18H19N7 — CID 141002897
2-[2-[1-(1-methylbenzimidazol-2-yl)ethyl]-3H-benzimidazol-5-yl]guanidine (PubChem CID 141002897) has the molecular formula C18H19N7 and a molecular weight of 333.40 g/mol. Its IUPAC name is 2-[2-[1-(1-methylbenzimidazol-2-yl)ethyl]-3H-benzimidazol-5-yl]guanidine.
| Compound Name | 2-[2-[1-(1-methylbenzimidazol-2-yl)ethyl]-3H-benzimidazol-5-yl]guanidine |
|---|---|
| PubChem CID | 141002897 |
| Molecular Formula | C18H19N7 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[2-[1-(1-methylbenzimidazol-2-yl)ethyl]-3H-benzimidazol-5-yl]guanidine |
| SMILES | CC(c1nc2ccc(N=C(N)N)cc2[nH]1)c1nc2ccccc2n1C |
| InChI | InChI=1S/C18H19N7/c1-10(17-24-13-5-3-4-6-15(13)25(17)2)16-22-12-8-7-11(21-18(19)20)9-14(12)23-16/h3-10H,1-2H3,(H,22,23)(H4,19,20,21) |
| InChIKey | OSQBWTYRASSUSX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|