C29H35NO6 — CID 138654087
[(1S,5S,9R,13S,17S)-7-cyano-17-ethyl-5,9,13,20-tetramethyl-2,8,18-trioxo-19-oxapentacyclo[15.2.1.01,14.04,13.05,10]icosa-3,6-dien-9-yl]methyl acetate (PubChem CID 138654087) has the molecular formula C29H35NO6 and a molecular weight of 493.60 g/mol. Its IUPAC name is [(1S,5S,9R,13S,17S)-7-cyano-17-ethyl-5,9,13,20-tetramethyl-2,8,18-trioxo-19-oxapentacyclo[15.2.1.01,14.04,13.05,10]icosa-3,6-dien-9-yl]methyl acetate.
| Compound Name | [(1S,5S,9R,13S,17S)-7-cyano-17-ethyl-5,9,13,20-tetramethyl-2,8,18-trioxo-19-oxapentacyclo[15.2.1.01,14.04,13.05,10]icosa-3,6-dien-9-yl]methyl acetate |
|---|---|
| PubChem CID | 138654087 |
| Molecular Formula | C29H35NO6 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | [(1S,5S,9R,13S,17S)-7-cyano-17-ethyl-5,9,13,20-tetramethyl-2,8,18-trioxo-19-oxapentacyclo[15.2.1.01,14.04,13.05,10]icosa-3,6-dien-9-yl]methyl acetate |
| SMILES | CC[C@@]12CCC3[C@](OC1=O)(C(=O)C=C1[C@@]4(C)C=C(C#N)C(=O)[C@@](C)(COC(C)=O)C4CC[C@]13C)C2C |
| InChI | InChI=1S/C29H35NO6/c1-7-28-11-9-20-25(4)10-8-19-26(5,13-18(14-30)23(33)27(19,6)15-35-17(3)31)21(25)12-22(32)29(20,16(28)2)36-24(28)34/h12-13,16,19-20H,7-11,15H2,1-6H3/t16?,19?,20?,25-,26-,27-,28-,29-/m0/s1 |
| InChIKey | LUPXSCXJQRLFGA-BYLGHRJESA-N |
| XLogP | 4.26 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |