C21H27NO3 — CID 138654738
(8S,12S,13S)-13-[2-(cyclopropylmethylamino)ethyl]-11-methylidene-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,8-diol (PubChem CID 138654738) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (8S,12S,13S)-13-[2-(cyclopropylmethylamino)ethyl]-11-methylidene-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,8-diol.
| Compound Name | (8S,12S,13S)-13-[2-(cyclopropylmethylamino)ethyl]-11-methylidene-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,8-diol |
|---|---|
| PubChem CID | 138654738 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (8S,12S,13S)-13-[2-(cyclopropylmethylamino)ethyl]-11-methylidene-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,8-diol |
| SMILES | C=C1CC[C@@]2(O)CCc3ccc(O)c4c3[C@@]2(CCNCC2CC2)[C@H]1O4 |
| InChI | InChI=1S/C21H27NO3/c1-13-6-8-20(24)9-7-15-4-5-16(23)18-17(15)21(20,19(13)25-18)10-11-22-12-14-2-3-14/h4-5,14,19,22-24H,1-3,6-12H2/t19-,20+,21-/m0/s1 |
| InChIKey | DFFNDRNYHSSITI-HBMCJLEFSA-N |
| XLogP | 2.81 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|