C23H31NO3 — CID 91254385
7-[cyclopropylmethyl(ethyl)amino]-13-ethyl-11-methylidene-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,8-diol (PubChem CID 91254385) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 7-[cyclopropylmethyl(ethyl)amino]-13-ethyl-11-methylidene-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,8-diol.
| Compound Name | 7-[cyclopropylmethyl(ethyl)amino]-13-ethyl-11-methylidene-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,8-diol |
|---|---|
| PubChem CID | 91254385 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 7-[cyclopropylmethyl(ethyl)amino]-13-ethyl-11-methylidene-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-triene-2,8-diol |
| SMILES | C=C1CCC2(O)C(N(CC)CC3CC3)Cc3ccc(O)c4c3C2(CC)C1O4 |
| InChI | InChI=1S/C23H31NO3/c1-4-22-19-16-8-9-17(25)20(19)27-21(22)14(3)10-11-23(22,26)18(12-16)24(5-2)13-15-6-7-15/h8-9,15,18,21,25-26H,3-7,10-13H2,1-2H3 |
| InChIKey | LYTAWCLUJHVVGI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|