C22H29NO5 — CID 70962577
2-[[(1S,5S,6R)-6-[cyclopropylmethyl(ethyl)amino]-11-hydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-yl]oxy]acetic acid (PubChem CID 70962577) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[[(1S,5S,6R)-6-[cyclopropylmethyl(ethyl)amino]-11-hydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-yl]oxy]acetic acid.
| Compound Name | 2-[[(1S,5S,6R)-6-[cyclopropylmethyl(ethyl)amino]-11-hydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 70962577 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[[(1S,5S,6R)-6-[cyclopropylmethyl(ethyl)amino]-11-hydroxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-yl]oxy]acetic acid |
| SMILES | CCN(CC1CC1)[C@@H]1Cc2ccc(O)c3c2C2[C@H](CCC[C@]21OCC(=O)O)O3 |
| InChI | InChI=1S/C22H29NO5/c1-2-23(11-13-5-6-13)17-10-14-7-8-15(24)21-19(14)20-16(28-21)4-3-9-22(17,20)27-12-18(25)26/h7-8,13,16-17,20,24H,2-6,9-12H2,1H3,(H,25,26)/t16-,17+,20?,22+/m0/s1 |
| InChIKey | ZDGWYKRUGRVIGS-MEBFWETISA-N |
| XLogP | 2.92 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |