C19H23NO5 — CID 66587836
7'-[ethyl(methyl)amino]spiro[1,3-dioxolane-2,11'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraene]-2',8'-diol (PubChem CID 66587836) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 7'-[ethyl(methyl)amino]spiro[1,3-dioxolane-2,11'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraene]-2',8'-diol.
| Compound Name | 7'-[ethyl(methyl)amino]spiro[1,3-dioxolane-2,11'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraene]-2',8'-diol |
|---|---|
| PubChem CID | 66587836 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 7'-[ethyl(methyl)amino]spiro[1,3-dioxolane-2,11'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraene]-2',8'-diol |
| SMILES | CCN(C)C1Cc2ccc(O)c3c2C2C(O3)C3(C=CC21O)OCCO3 |
| InChI | InChI=1S/C19H23NO5/c1-3-20(2)13-10-11-4-5-12(21)16-14(11)15-17(25-16)19(23-8-9-24-19)7-6-18(13,15)22/h4-7,13,15,17,21-22H,3,8-10H2,1-2H3 |
| InChIKey | PXMUKGBMRZNFHK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|