C19H24NO2Y- — CID 59167313
7-ethyl-4a-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-id-9-ol;yttrium (PubChem CID 59167313) has the molecular formula C19H24NO2Y- and a molecular weight of 387.31 g/mol. Its IUPAC name is 7-ethyl-4a-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-id-9-ol;yttrium.
| Compound Name | 7-ethyl-4a-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-id-9-ol;yttrium |
|---|---|
| PubChem CID | 59167313 |
| Molecular Formula | C19H24NO2Y- |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 7-ethyl-4a-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-id-9-ol;yttrium |
| SMILES | CCC1CCC2(C)C3Cc4ccc(O)c5c4C2(CC[N-]3)C1O5.[Y] |
| InChI | InChI=1S/C19H24NO2.Y/c1-3-11-6-7-18(2)14-10-12-4-5-13(21)16-15(12)19(18,8-9-20-14)17(11)22-16;/h4-5,11,14,17,21H,3,6-10H2,1-2H3;/q-1; |
| InChIKey | QBDFFPVYIPSEIW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |