C29H35NO5 — CID 89265122
(1R,5S,6R)-N-(cyclopropylmethyl)-N-ethyl-11-hydroxy-2-oxo-5-(3-phenylpropoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-amine oxide (PubChem CID 89265122) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is (1R,5S,6R)-N-(cyclopropylmethyl)-N-ethyl-11-hydroxy-2-oxo-5-(3-phenylpropoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-amine oxide.
| Compound Name | (1R,5S,6R)-N-(cyclopropylmethyl)-N-ethyl-11-hydroxy-2-oxo-5-(3-phenylpropoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-amine oxide |
|---|---|
| PubChem CID | 89265122 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (1R,5S,6R)-N-(cyclopropylmethyl)-N-ethyl-11-hydroxy-2-oxo-5-(3-phenylpropoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-amine oxide |
| SMILES | CC[N+]([O-])(CC1CC1)[C@@H]1Cc2ccc(O)c3c2C2[C@@H](O3)C(=O)CC[C@]21OCCCc1ccccc1 |
| InChI | InChI=1S/C29H35NO5/c1-2-30(33,18-20-10-11-20)24-17-21-12-13-22(31)27-25(21)26-28(35-27)23(32)14-15-29(24,26)34-16-6-9-19-7-4-3-5-8-19/h3-5,7-8,12-13,20,24,26,28,31H,2,6,9-11,14-18H2,1H3/t24-,26?,28+,29-,30?/m1/s1 |
| InChIKey | HMZJKRRVRJFOTN-FTBNKIDXSA-N |
| XLogP | 4.66 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|