C24H36NO5+ — CID 71098356
cyclopropylmethyl-ethyl-methyl-[(1R,2R,5S,6R)-2,5,11-trihydroxy-4-propoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]azanium (PubChem CID 71098356) has the molecular formula C24H36NO5+ and a molecular weight of 418.55 g/mol. Its IUPAC name is cyclopropylmethyl-ethyl-methyl-[(1R,2R,5S,6R)-2,5,11-trihydroxy-4-propoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]azanium.
| Compound Name | cyclopropylmethyl-ethyl-methyl-[(1R,2R,5S,6R)-2,5,11-trihydroxy-4-propoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]azanium |
|---|---|
| PubChem CID | 71098356 |
| Molecular Formula | C24H36NO5+ |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | cyclopropylmethyl-ethyl-methyl-[(1R,2R,5S,6R)-2,5,11-trihydroxy-4-propoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]azanium |
| SMILES | CCCOC1C[C@@H](O)[C@@H]2Oc3c(O)ccc4c3C2[C@]1(O)[C@H]([N+](C)(CC)CC1CC1)C4 |
| InChI | InChI=1S/C24H35NO5/c1-4-10-29-19-12-17(27)23-21-20-15(8-9-16(26)22(20)30-23)11-18(24(19,21)28)25(3,5-2)13-14-6-7-14/h8-9,14,17-19,21,23,27-28H,4-7,10-13H2,1-3H3/p+1/t17-,18-,19?,21?,23+,24+,25?/m1/s1 |
| InChIKey | DPGIQTQAOIIAKQ-YUJBPIOISA-O |
| XLogP | 2.33 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|