C27H33N5O3 — CID 138656433
6-[2-amino-4-[(dipropylamino)-hydroxymethyl]-3H-1-benzazepin-8-yl]-2-(2-hydroxyethyl)phthalazin-1-one (PubChem CID 138656433) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is 6-[2-amino-4-[(dipropylamino)-hydroxymethyl]-3H-1-benzazepin-8-yl]-2-(2-hydroxyethyl)phthalazin-1-one.
| Compound Name | 6-[2-amino-4-[(dipropylamino)-hydroxymethyl]-3H-1-benzazepin-8-yl]-2-(2-hydroxyethyl)phthalazin-1-one |
|---|---|
| PubChem CID | 138656433 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 6-[2-amino-4-[(dipropylamino)-hydroxymethyl]-3H-1-benzazepin-8-yl]-2-(2-hydroxyethyl)phthalazin-1-one |
| SMILES | CCCN(CCC)C(O)C1=Cc2ccc(-c3ccc4c(=O)n(CCO)ncc4c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C27H33N5O3/c1-3-9-31(10-4-2)26(34)21-14-20-6-5-19(15-24(20)30-25(28)16-21)18-7-8-23-22(13-18)17-29-32(11-12-33)27(23)35/h5-8,13-15,17,26,33-34H,3-4,9-12,16H2,1-2H3,(H2,28,30) |
| InChIKey | NSNNZNDMQRZFGL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|