C26H33N3O4 — CID 123610224
methyl 2-[4-[2-amino-4-[hydroxy-[3-hydroxypropyl(propyl)amino]methyl]-3H-1-benzazepin-8-yl]phenyl]acetate (PubChem CID 123610224) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is methyl 2-[4-[2-amino-4-[hydroxy-[3-hydroxypropyl(propyl)amino]methyl]-3H-1-benzazepin-8-yl]phenyl]acetate.
| Compound Name | methyl 2-[4-[2-amino-4-[hydroxy-[3-hydroxypropyl(propyl)amino]methyl]-3H-1-benzazepin-8-yl]phenyl]acetate |
|---|---|
| PubChem CID | 123610224 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | methyl 2-[4-[2-amino-4-[hydroxy-[3-hydroxypropyl(propyl)amino]methyl]-3H-1-benzazepin-8-yl]phenyl]acetate |
| SMILES | CCCN(CCCO)C(O)C1=Cc2ccc(-c3ccc(CC(=O)OC)cc3)cc2N=C(N)C1 |
| InChI | InChI=1S/C26H33N3O4/c1-3-11-29(12-4-13-30)26(32)22-15-21-10-9-20(16-23(21)28-24(27)17-22)19-7-5-18(6-8-19)14-25(31)33-2/h5-10,15-16,26,30,32H,3-4,11-14,17H2,1-2H3,(H2,27,28) |
| InChIKey | VDAVBVZONRGZSO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|