C19H19N7O2 — CID 138656526
1,3-diamino-1-[(3-cyanophenyl)methyl]-3-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]urea (PubChem CID 138656526) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 1,3-diamino-1-[(3-cyanophenyl)methyl]-3-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]urea.
| Compound Name | 1,3-diamino-1-[(3-cyanophenyl)methyl]-3-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 138656526 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1,3-diamino-1-[(3-cyanophenyl)methyl]-3-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]urea |
| SMILES | COc1cc(N(N)C(=O)N(N)Cc2cccc(C#N)c2)ccc1-c1cn[nH]c1 |
| InChI | InChI=1S/C19H19N7O2/c1-28-18-8-16(5-6-17(18)15-10-23-24-11-15)26(22)19(27)25(21)12-14-4-2-3-13(7-14)9-20/h2-8,10-11H,12,21-22H2,1H3,(H,23,24) |
| InChIKey | LLESJTYYWTVAGT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|