C23H35N3O5 — CID 138657944
tert-butyl N-[1-[3-formyl-7-(3-methoxypropoxy)indazol-2-yl]-3,3-dimethylbutan-2-yl]carbamate (PubChem CID 138657944) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl N-[1-[3-formyl-7-(3-methoxypropoxy)indazol-2-yl]-3,3-dimethylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-formyl-7-(3-methoxypropoxy)indazol-2-yl]-3,3-dimethylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138657944 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | tert-butyl N-[1-[3-formyl-7-(3-methoxypropoxy)indazol-2-yl]-3,3-dimethylbutan-2-yl]carbamate |
| SMILES | COCCCOc1cccc2c(C=O)n(CC(NC(=O)OC(C)(C)C)C(C)(C)C)nc12 |
| InChI | InChI=1S/C23H35N3O5/c1-22(2,3)19(24-21(28)31-23(4,5)6)14-26-17(15-27)16-10-8-11-18(20(16)25-26)30-13-9-12-29-7/h8,10-11,15,19H,9,12-14H2,1-7H3,(H,24,28) |
| InChIKey | ZAZKSQCYQPCFSZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|