C8H14S2 — CID 138659662
(2E,4E)-2,4-bis(methylsulfanyl)hexa-2,4-diene (PubChem CID 138659662) has the molecular formula C8H14S2 and a molecular weight of 174.33 g/mol. Its IUPAC name is (2E,4E)-2,4-bis(methylsulfanyl)hexa-2,4-diene.
| Compound Name | (2E,4E)-2,4-bis(methylsulfanyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 138659662 |
| Molecular Formula | C8H14S2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (2E,4E)-2,4-bis(methylsulfanyl)hexa-2,4-diene |
| SMILES | C/C=C(\C=C(/C)SC)SC |
| InChI | InChI=1S/C8H14S2/c1-5-8(10-4)6-7(2)9-3/h5-6H,1-4H3/b7-6+,8-5+ |
| InChIKey | XXNWNFBPNRUVEX-ZCOYIIAOSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|