C26H26O6 — CID 138664064
3-[3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxo-3,4-dihydrochromen-7-yl]propyl 2-methylprop-2-enoate (PubChem CID 138664064) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 3-[3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxo-3,4-dihydrochromen-7-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxo-3,4-dihydrochromen-7-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138664064 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-[3-[4-(2-methylprop-2-enoyloxy)phenyl]-2-oxo-3,4-dihydrochromen-7-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc2c(c1)OC(=O)C(c1ccc(OC(=O)C(=C)C)cc1)C2 |
| InChI | InChI=1S/C26H26O6/c1-16(2)24(27)30-13-5-6-18-7-8-20-15-22(26(29)32-23(20)14-18)19-9-11-21(12-10-19)31-25(28)17(3)4/h7-12,14,22H,1,3,5-6,13,15H2,2,4H3 |
| InChIKey | OBIYYAKTKXXBJW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|