C21H27F2N3O2 — CID 138665511
N-[[4-(difluoromethoxy)phenyl]methyl]-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enamide (PubChem CID 138665511) has the molecular formula C21H27F2N3O2 and a molecular weight of 391.46 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 138665511 |
| Molecular Formula | C21H27F2N3O2 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enamide |
| SMILES | C=N/C(NC1(C)CC1)=C(\C)C(C(=O)NCc1ccc(OC(F)F)cc1)=C(C)C |
| InChI | InChI=1S/C21H27F2N3O2/c1-13(2)17(14(3)18(24-5)26-21(4)10-11-21)19(27)25-12-15-6-8-16(9-7-15)28-20(22)23/h6-9,20,26H,5,10-12H2,1-4H3,(H,25,27)/b18-14- |
| InChIKey | JKDTYIIHPPZMJD-JXAWBTAJSA-N |
| XLogP | 4.31 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|