C14H26N2O3 — CID 138666376
[1-(aminomethyl)-3,5,7-trimethyl-3-bicyclo[3.3.1]nonanyl]methyl nitrate (PubChem CID 138666376) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is [1-(aminomethyl)-3,5,7-trimethyl-3-bicyclo[3.3.1]nonanyl]methyl nitrate.
| Compound Name | [1-(aminomethyl)-3,5,7-trimethyl-3-bicyclo[3.3.1]nonanyl]methyl nitrate |
|---|---|
| PubChem CID | 138666376 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | [1-(aminomethyl)-3,5,7-trimethyl-3-bicyclo[3.3.1]nonanyl]methyl nitrate |
| SMILES | CC1CC2(C)CC(C)(CO[N+](=O)[O-])CC(CN)(C1)C2 |
| InChI | InChI=1S/C14H26N2O3/c1-11-4-12(2)6-13(3,10-19-16(17)18)8-14(5-11,7-12)9-15/h11H,4-10,15H2,1-3H3 |
| InChIKey | PZSDSIHWTAYZBS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|