C13H24N2O3 — CID 155354826
[3-(aminomethyl)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]methyl nitrate (PubChem CID 155354826) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is [3-(aminomethyl)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]methyl nitrate.
| Compound Name | [3-(aminomethyl)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]methyl nitrate |
|---|---|
| PubChem CID | 155354826 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | [3-(aminomethyl)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]methyl nitrate |
| SMILES | CC1CC2CC(C)(CN)CC(CO[N+](=O)[O-])(C1)C2 |
| InChI | InChI=1S/C13H24N2O3/c1-10-3-11-5-12(2,8-14)7-13(4-10,6-11)9-18-15(16)17/h10-11H,3-9,14H2,1-2H3 |
| InChIKey | FIPCGNSAJRHFOX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|