C23H23F3N4O5 — CID 138669567
2-[2-[[[2-methyl-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoyl]amino]propyl]amino]oxymethyl]phenyl]acetic acid (PubChem CID 138669567) has the molecular formula C23H23F3N4O5 and a molecular weight of 492.45 g/mol. Its IUPAC name is 2-[2-[[[2-methyl-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoyl]amino]propyl]amino]oxymethyl]phenyl]acetic acid.
| Compound Name | 2-[2-[[[2-methyl-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoyl]amino]propyl]amino]oxymethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 138669567 |
| Molecular Formula | C23H23F3N4O5 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-[2-[[[2-methyl-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoyl]amino]propyl]amino]oxymethyl]phenyl]acetic acid |
| SMILES | CC(CNOCc1ccccc1CC(=O)O)CNC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C23H23F3N4O5/c1-14(12-28-34-13-18-5-3-2-4-17(18)10-19(31)32)11-27-21(33)16-8-6-15(7-9-16)20-29-22(35-30-20)23(24,25)26/h2-9,14,28H,10-13H2,1H3,(H,27,33)(H,31,32) |
| InChIKey | NKEUBWXSJBPCAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|