C18H21N3O2 — CID 138670155
1-[(E)-3-(1-pyridin-2-ylpiperidin-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 138670155) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 1-[(E)-3-(1-pyridin-2-ylpiperidin-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(E)-3-(1-pyridin-2-ylpiperidin-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 138670155 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-[(E)-3-(1-pyridin-2-ylpiperidin-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1C(=O)/C=C/C1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H21N3O2/c22-17-6-2-4-12-21(17)18(23)8-7-15-9-13-20(14-10-15)16-5-1-3-11-19-16/h1-3,5-8,11,15H,4,9-10,12-14H2/b8-7+ |
| InChIKey | SCQNXQUNSQUUEQ-BQYQJAHWSA-N |
| XLogP | 2.17 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|