C17H20N4O2 — CID 138634683
1-[(E)-3-(1-pyrimidin-2-ylpiperidin-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 138634683) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-[(E)-3-(1-pyrimidin-2-ylpiperidin-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(E)-3-(1-pyrimidin-2-ylpiperidin-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 138634683 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[(E)-3-(1-pyrimidin-2-ylpiperidin-4-yl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1C(=O)/C=C/C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H20N4O2/c22-15-4-1-2-11-21(15)16(23)6-5-14-7-12-20(13-8-14)17-18-9-3-10-19-17/h1,3-6,9-10,14H,2,7-8,11-13H2/b6-5+ |
| InChIKey | SSMCYSMUOKWPJZ-AATRIKPKSA-N |
| XLogP | 1.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|