C12H11N3O2 — CID 155338510
1-(3-pyridazin-3-ylprop-2-enoyl)-2,3-dihydropyridin-6-one (PubChem CID 155338510) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-(3-pyridazin-3-ylprop-2-enoyl)-2,3-dihydropyridin-6-one.
| Compound Name | 1-(3-pyridazin-3-ylprop-2-enoyl)-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 155338510 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(3-pyridazin-3-ylprop-2-enoyl)-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1C(=O)C=Cc1cccnn1 |
| InChI | InChI=1S/C12H11N3O2/c16-11-5-1-2-9-15(11)12(17)7-6-10-4-3-8-13-14-10/h1,3-8H,2,9H2 |
| InChIKey | FBMJVVQLNPTRFG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|