C25H29F4N3O4S — CID 138670821
N-[4-[2-[2-(2,2-difluoropropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-2,2-difluoro-1,3-benzodioxole-4-carboxamide (PubChem CID 138670821) has the molecular formula C25H29F4N3O4S and a molecular weight of 543.58 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-difluoropropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-2,2-difluoro-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-[4-[2-[2-(2,2-difluoropropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-2,2-difluoro-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 138670821 |
| Molecular Formula | C25H29F4N3O4S |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | N-[4-[2-[2-(2,2-difluoropropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-2,2-difluoro-1,3-benzodioxole-4-carboxamide |
| SMILES | CC(F)(F)COc1nc2c(s1)CCN(CCC1CCC(NC(=O)c3cccc4c3OC(F)(F)O4)CC1)C2 |
| InChI | InChI=1S/C25H29F4N3O4S/c1-24(26,27)14-34-23-31-18-13-32(12-10-20(18)37-23)11-9-15-5-7-16(8-6-15)30-22(33)17-3-2-4-19-21(17)36-25(28,29)35-19/h2-4,15-16H,5-14H2,1H3,(H,30,33) |
| InChIKey | UUDIUUVTJYLLOL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |