C25H31F2N3O4S — CID 138671557
N-[4-[2-[2-(2,2-difluoropropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-1,3-benzodioxole-4-carboxamide (PubChem CID 138671557) has the molecular formula C25H31F2N3O4S and a molecular weight of 507.60 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-difluoropropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-[4-[2-[2-(2,2-difluoropropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 138671557 |
| Molecular Formula | C25H31F2N3O4S |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | N-[4-[2-[2-(2,2-difluoropropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]-1,3-benzodioxole-4-carboxamide |
| SMILES | CC(F)(F)COc1nc2c(s1)CCN(CCC1CCC(NC(=O)c3cccc4c3OCO4)CC1)C2 |
| InChI | InChI=1S/C25H31F2N3O4S/c1-25(26,27)14-32-24-29-19-13-30(12-10-21(19)35-24)11-9-16-5-7-17(8-6-16)28-23(31)18-3-2-4-20-22(18)34-15-33-20/h2-4,16-17H,5-15H2,1H3,(H,28,31) |
| InChIKey | JZOWURIPXDKZFS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |