C23H29F3N4O2S — CID 138671636
2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]pyridine-3-carboxamide (PubChem CID 138671636) has the molecular formula C23H29F3N4O2S and a molecular weight of 482.57 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138671636 |
| Molecular Formula | C23H29F3N4O2S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl]ethyl]cyclohexyl]pyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)NC1CCC(CCN2CCc3sc(OCC(F)(F)F)nc3C2)CC1 |
| InChI | InChI=1S/C23H29F3N4O2S/c1-15-18(3-2-10-27-15)21(31)28-17-6-4-16(5-7-17)8-11-30-12-9-20-19(13-30)29-22(33-20)32-14-23(24,25)26/h2-3,10,16-17H,4-9,11-14H2,1H3,(H,28,31) |
| InChIKey | GJCNUKKVVZQSJA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |