C7H12NO3+ — CID 138678010
3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid (PubChem CID 138678010) has the molecular formula C7H12NO3+ and a molecular weight of 158.18 g/mol. Its IUPAC name is 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid.
| Compound Name | 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 138678010 |
| Molecular Formula | C7H12NO3+ |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid |
| SMILES | CC1OC(C(=O)O)=[N+](C)C1C |
| InChI | InChI=1S/C7H11NO3/c1-4-5(2)11-6(7(9)10)8(4)3/h4-5H,1-3H3/p+1 |
| InChIKey | OIJQUBFYTWPELO-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|