3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid

C7H12NO3+ — CID 138678010

IUPAC3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid
SMILESCC1OC(C(=O)O)=[N+](C)C1C
InChIInChI=1S/C7H11NO3/c1-4-5(2)11-6(7(9)10)8(4)3/h4-5H,1-3H3/p+1
InChIKeyOIJQUBFYTWPELO-UHFFFAOYSA-O
MW158.18 g/mol
LogP-0.08
Rot. Bonds1

About 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid

3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid (PubChem CID 138678010) has the molecular formula C7H12NO3+ and a molecular weight of 158.18 g/mol. Its IUPAC name is 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid.

Molecular Properties

Compound Name3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid
PubChem CID138678010
Molecular FormulaC7H12NO3+
Molecular Weight158.18 g/mol
Exact Mass158.08
IUPAC Name3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid
SMILESCC1OC(C(=O)O)=[N+](C)C1C
InChIInChI=1S/C7H11NO3/c1-4-5(2)11-6(7(9)10)8(4)3/h4-5H,1-3H3/p+1
InChIKeyOIJQUBFYTWPELO-UHFFFAOYSA-O
XLogP-0.08
TPSA49.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.18
LogP ≤ 5-0.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid?
The IUPAC name of 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid (CID 138678010) is 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid.
What is the SMILES notation for 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid?
The canonical SMILES for 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid is CC1OC(C(=O)O)=[N+](C)C1C.
What is the InChIKey of 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid?
The InChIKey is OIJQUBFYTWPELO-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H11NO3/c1-4-5(2)11-6(7(9)10)8(4)3/h4-5H,1-3H3/p+1.
What are the key properties of 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid?
3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid has a molecular weight of 158.18 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trimethyl-4,5-dihydro-1,3-oxazol-3-ium-2-carboxylic acid is sourced from PubChem (CID 138678010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).