C7H11NO3 — CID 11805021
(2S,3S)-2,3,5-trimethyl-4-oxido-2,3-dihydro-1,4-oxazin-4-ium-6-one (PubChem CID 11805021) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is (2S,3S)-2,3,5-trimethyl-4-oxido-2,3-dihydro-1,4-oxazin-4-ium-6-one.
| Compound Name | (2S,3S)-2,3,5-trimethyl-4-oxido-2,3-dihydro-1,4-oxazin-4-ium-6-one |
|---|---|
| PubChem CID | 11805021 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (2S,3S)-2,3,5-trimethyl-4-oxido-2,3-dihydro-1,4-oxazin-4-ium-6-one |
| SMILES | CC1=[N+]([O-])[C@@H](C)[C@H](C)OC1=O |
| InChI | InChI=1S/C7H11NO3/c1-4-6(3)11-7(9)5(2)8(4)10/h4,6H,1-3H3/t4-,6-/m0/s1 |
| InChIKey | QKOPLLMRUJZUKQ-NJGYIYPDSA-N |
| XLogP | 0.29 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|