C6H8O3S — CID 11693946
(4S,5R)-4,5-dimethyl-3-sulfinyloxolan-2-one (PubChem CID 11693946) has the molecular formula C6H8O3S and a molecular weight of 160.19 g/mol. Its IUPAC name is (4S,5R)-4,5-dimethyl-3-sulfinyloxolan-2-one.
| Compound Name | (4S,5R)-4,5-dimethyl-3-sulfinyloxolan-2-one |
|---|---|
| PubChem CID | 11693946 |
| Molecular Formula | C6H8O3S |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | (4S,5R)-4,5-dimethyl-3-sulfinyloxolan-2-one |
| SMILES | C[C@@H]1C(=S=O)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C6H8O3S/c1-3-4(2)9-6(7)5(3)10-8/h3-4H,1-2H3/t3-,4+/m0/s1 |
| InChIKey | DRFVIKQTUKOQGG-IUYQGCFVSA-N |
| XLogP | -0.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|