C5H6O4 — CID 54676244
3,4-dihydroxy-2-methyl-2H-furan-5-one (PubChem CID 54676244) has the molecular formula C5H6O4 and a molecular weight of 130.10 g/mol. Its IUPAC name is 3,4-dihydroxy-2-methyl-2H-furan-5-one.
| Compound Name | 3,4-dihydroxy-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 54676244 |
| Molecular Formula | C5H6O4 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 3,4-dihydroxy-2-methyl-2H-furan-5-one |
| SMILES | CC1OC(=O)C(O)=C1O |
| InChI | InChI=1S/C5H6O4/c1-2-3(6)4(7)5(8)9-2/h2,6-7H,1H3 |
| InChIKey | ASEPVSZWYGTTAB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |