C6H9N2O3S+ — CID 136835066
(5S,6R)-4-hydroxy-5,6-dimethyl-2-oxo-1-oxa-4λ4-thiacyclohex-3-ene-3-diazonium (PubChem CID 136835066) has the molecular formula C6H9N2O3S+ and a molecular weight of 189.22 g/mol. Its IUPAC name is (5S,6R)-4-hydroxy-5,6-dimethyl-2-oxo-1-oxa-4λ4-thiacyclohex-3-ene-3-diazonium.
| Compound Name | (5S,6R)-4-hydroxy-5,6-dimethyl-2-oxo-1-oxa-4λ4-thiacyclohex-3-ene-3-diazonium |
|---|---|
| PubChem CID | 136835066 |
| Molecular Formula | C6H9N2O3S+ |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | (5S,6R)-4-hydroxy-5,6-dimethyl-2-oxo-1-oxa-4λ4-thiacyclohex-3-ene-3-diazonium |
| SMILES | C[C@H]1OC(=O)C([N+]#N)=S(O)[C@H]1C |
| InChI | InChI=1S/C6H8N2O3S/c1-3-4(2)12(10)5(8-7)6(9)11-3/h3-4H,1-2H3/p+1/t3-,4+,12?/m1/s1 |
| InChIKey | IPZIQTSFWOGBJA-PBXFGCFMSA-O |
| XLogP | 1.05 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|