C12H20F8INO — CID 138687376
diethyl-methyl-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]azanium iodide (PubChem CID 138687376) has the molecular formula C12H20F8INO and a molecular weight of 473.19 g/mol. Its IUPAC name is diethyl-methyl-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]azanium iodide.
| Compound Name | diethyl-methyl-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]azanium iodide |
|---|---|
| PubChem CID | 138687376 |
| Molecular Formula | C12H20F8INO |
| Molecular Weight | 473.19 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | diethyl-methyl-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]azanium iodide |
| SMILES | CC[N+](C)(CC)C(C)OCC(F)(F)C(F)(F)C(F)(F)C(F)F.[I-] |
| InChI | InChI=1S/C12H20F8NO.HI/c1-5-21(4,6-2)8(3)22-7-10(15,16)12(19,20)11(17,18)9(13)14;/h8-9H,5-7H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | RUDWSPTXNUGKJN-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|