C12H20F8NO+ — CID 134276378
diethyl-methyl-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]azanium (PubChem CID 134276378) has the molecular formula C12H20F8NO+ and a molecular weight of 346.28 g/mol. Its IUPAC name is diethyl-methyl-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]azanium.
| Compound Name | diethyl-methyl-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]azanium |
|---|---|
| PubChem CID | 134276378 |
| Molecular Formula | C12H20F8NO+ |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | diethyl-methyl-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]azanium |
| SMILES | CC[N+](C)(CC)CCOCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H20F8NO/c1-4-21(3,5-2)6-7-22-8-10(15,16)12(19,20)11(17,18)9(13)14/h9H,4-8H2,1-3H3/q+1 |
| InChIKey | GYAXFTCRZPXXPU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|