C20H24N2O5 — CID 138688169
bis(2-ethyl-6-methyl-3-pyridinyl) (2S)-2-hydroxybutanedioate (PubChem CID 138688169) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is bis(2-ethyl-6-methyl-3-pyridinyl) (2S)-2-hydroxybutanedioate.
| Compound Name | bis(2-ethyl-6-methyl-3-pyridinyl) (2S)-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 138688169 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | bis(2-ethyl-6-methyl-3-pyridinyl) (2S)-2-hydroxybutanedioate |
| SMILES | CCc1nc(C)ccc1OC(=O)C[C@H](O)C(=O)Oc1ccc(C)nc1CC |
| InChI | InChI=1S/C20H24N2O5/c1-5-14-17(9-7-12(3)21-14)26-19(24)11-16(23)20(25)27-18-10-8-13(4)22-15(18)6-2/h7-10,16,23H,5-6,11H2,1-4H3/t16-/m0/s1 |
| InChIKey | LSRYORAEVWYLAR-INIZCTEOSA-N |
| XLogP | 2.48 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |