C28H31F5N4O — CID 138692641
1-[3-(4-amino-2,5-difluorophenyl)-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-5-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one (PubChem CID 138692641) has the molecular formula C28H31F5N4O and a molecular weight of 534.57 g/mol. Its IUPAC name is 1-[3-(4-amino-2,5-difluorophenyl)-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-5-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one.
| Compound Name | 1-[3-(4-amino-2,5-difluorophenyl)-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-5-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 138692641 |
| Molecular Formula | C28H31F5N4O |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 1-[3-(4-amino-2,5-difluorophenyl)-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-5-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-one |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c(N)cc1F)CN(C(=O)C(C)(C)C(F)(F)F)C2(C)C |
| InChI | InChI=1S/C28H31F5N4O/c1-7-15-10-9-11-16(8-2)22(15)37-23(17-12-20(30)21(34)13-19(17)29)18-14-36(27(5,6)24(18)35-37)25(38)26(3,4)28(31,32)33/h9-13H,7-8,14,34H2,1-6H3 |
| InChIKey | XHXYAULCCKJECX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|